C27H36N2O4 — CID 90483695
oxalic acid;1-(4-phenylcyclohexyl)-4-(3-phenylpropyl)piperazine (PubChem CID 90483695) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is oxalic acid;1-(4-phenylcyclohexyl)-4-(3-phenylpropyl)piperazine.
| Compound Name | oxalic acid;1-(4-phenylcyclohexyl)-4-(3-phenylpropyl)piperazine |
|---|---|
| PubChem CID | 90483695 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | oxalic acid;1-(4-phenylcyclohexyl)-4-(3-phenylpropyl)piperazine |
| SMILES | O=C(O)C(=O)O.c1ccc(CCCN2CCN(C3CCC(c4ccccc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C25H34N2.C2H2O4/c1-3-8-22(9-4-1)10-7-17-26-18-20-27(21-19-26)25-15-13-24(14-16-25)23-11-5-2-6-12-23;3-1(4)2(5)6/h1-6,8-9,11-12,24-25H,7,10,13-21H2;(H,3,4)(H,5,6) |
| InChIKey | PDXMTBJFBHAMNF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|