C27H37N3O5 — CID 17369301
1-(2-methoxyphenyl)-4-[1-(3-phenylpropyl)piperidin-4-yl]piperazine;oxalic acid (PubChem CID 17369301) has the molecular formula C27H37N3O5 and a molecular weight of 483.61 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-4-[1-(3-phenylpropyl)piperidin-4-yl]piperazine;oxalic acid.
| Compound Name | 1-(2-methoxyphenyl)-4-[1-(3-phenylpropyl)piperidin-4-yl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 17369301 |
| Molecular Formula | C27H37N3O5 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | 1-(2-methoxyphenyl)-4-[1-(3-phenylpropyl)piperidin-4-yl]piperazine;oxalic acid |
| SMILES | COc1ccccc1N1CCN(C2CCN(CCCc3ccccc3)CC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H35N3O.C2H2O4/c1-29-25-12-6-5-11-24(25)28-20-18-27(19-21-28)23-13-16-26(17-14-23)15-7-10-22-8-3-2-4-9-22;3-1(4)2(5)6/h2-6,8-9,11-12,23H,7,10,13-21H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | MEWRYTOOMQINEQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|