C27H37N3O7 — CID 90484045
oxalic acid;1-phenyl-4-[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]piperazine (PubChem CID 90484045) has the molecular formula C27H37N3O7 and a molecular weight of 515.61 g/mol. Its IUPAC name is oxalic acid;1-phenyl-4-[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]piperazine.
| Compound Name | oxalic acid;1-phenyl-4-[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]piperazine |
|---|---|
| PubChem CID | 90484045 |
| Molecular Formula | C27H37N3O7 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | oxalic acid;1-phenyl-4-[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]piperazine |
| SMILES | COc1cc(CN2CCC(N3CCN(c4ccccc4)CC3)CC2)cc(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H35N3O3.C2H2O4/c1-29-23-17-20(18-24(30-2)25(23)31-3)19-26-11-9-22(10-12-26)28-15-13-27(14-16-28)21-7-5-4-6-8-21;3-1(4)2(5)6/h4-8,17-18,22H,9-16,19H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | RNQRBXBBLVVNRO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|