C23H30N4O4 — CID 2912739
oxalic acid;1-phenyl-4-[1-(pyridin-2-ylmethyl)piperidin-4-yl]piperazine (PubChem CID 2912739) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is oxalic acid;1-phenyl-4-[1-(pyridin-2-ylmethyl)piperidin-4-yl]piperazine.
| Compound Name | oxalic acid;1-phenyl-4-[1-(pyridin-2-ylmethyl)piperidin-4-yl]piperazine |
|---|---|
| PubChem CID | 2912739 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | oxalic acid;1-phenyl-4-[1-(pyridin-2-ylmethyl)piperidin-4-yl]piperazine |
| SMILES | O=C(O)C(=O)O.c1ccc(N2CCN(C3CCN(Cc4ccccn4)CC3)CC2)cc1 |
| InChI | InChI=1S/C21H28N4.C2H2O4/c1-2-7-20(8-3-1)24-14-16-25(17-15-24)21-9-12-23(13-10-21)18-19-6-4-5-11-22-19;3-1(4)2(5)6/h1-8,11,21H,9-10,12-18H2;(H,3,4)(H,5,6) |
| InChIKey | CFOXJYDOSDAYNM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|