C15H22N4O2 — CID 170207462
2-[(1Z)-1,4,4-triamino-3-(2-methylmorpholin-4-yl)buta-1,3-dienyl]phenol (PubChem CID 170207462) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-[(1Z)-1,4,4-triamino-3-(2-methylmorpholin-4-yl)buta-1,3-dienyl]phenol.
| Compound Name | 2-[(1Z)-1,4,4-triamino-3-(2-methylmorpholin-4-yl)buta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 170207462 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-[(1Z)-1,4,4-triamino-3-(2-methylmorpholin-4-yl)buta-1,3-dienyl]phenol |
| SMILES | CC1CN(C(/C=C(\N)c2ccccc2O)=C(N)N)CCO1 |
| InChI | InChI=1S/C15H22N4O2/c1-10-9-19(6-7-21-10)13(15(17)18)8-12(16)11-4-2-3-5-14(11)20/h2-5,8,10,20H,6-7,9,16-18H2,1H3/b12-8- |
| InChIKey | KUXFBBWWTOKBCW-WQLSENKSSA-N |
| XLogP | 0.50 |
| TPSA | 110.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|