C26H34N4O2 — CID 176562077
1-[3-methyl-4-[1-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]piperidin-3-yl]phenyl]butan-1-one (PubChem CID 176562077) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is 1-[3-methyl-4-[1-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]piperidin-3-yl]phenyl]butan-1-one.
| Compound Name | 1-[3-methyl-4-[1-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]piperidin-3-yl]phenyl]butan-1-one |
|---|---|
| PubChem CID | 176562077 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 1-[3-methyl-4-[1-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]piperidin-3-yl]phenyl]butan-1-one |
| SMILES | CCCC(=O)c1ccc(C2CCCN(C(/C=C(\N)c3ccccc3O)=C(N)N)C2)c(C)c1 |
| InChI | InChI=1S/C26H34N4O2/c1-3-7-24(31)18-11-12-20(17(2)14-18)19-8-6-13-30(16-19)23(26(28)29)15-22(27)21-9-4-5-10-25(21)32/h4-5,9-12,14-15,19,32H,3,6-8,13,16,27-29H2,1-2H3/b22-15- |
| InChIKey | BXUYOXQUWGPOQS-JCMHNJIXSA-N |
| XLogP | 3.95 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|