C25H32N4O3 — CID 176562704
ethyl 4-[5-methyl-1-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]piperidin-3-yl]benzoate (PubChem CID 176562704) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is ethyl 4-[5-methyl-1-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]piperidin-3-yl]benzoate.
| Compound Name | ethyl 4-[5-methyl-1-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]piperidin-3-yl]benzoate |
|---|---|
| PubChem CID | 176562704 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | ethyl 4-[5-methyl-1-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]piperidin-3-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(C2CC(C)CN(C(/C=C(\N)c3ccccc3O)=C(N)N)C2)cc1 |
| InChI | InChI=1S/C25H32N4O3/c1-3-32-25(31)18-10-8-17(9-11-18)19-12-16(2)14-29(15-19)22(24(27)28)13-21(26)20-6-4-5-7-23(20)30/h4-11,13,16,19,30H,3,12,14-15,26-28H2,1-2H3/b21-13- |
| InChIKey | RUIIGOHTUVWVRM-BKUYFWCQSA-N |
| XLogP | 3.08 |
| TPSA | 127.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|