C23H28N4O4 — CID 176562897
4-[4-methoxy-1-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]piperidin-3-yl]benzoic acid (PubChem CID 176562897) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 4-[4-methoxy-1-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]piperidin-3-yl]benzoic acid.
| Compound Name | 4-[4-methoxy-1-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]piperidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 176562897 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 4-[4-methoxy-1-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]piperidin-3-yl]benzoic acid |
| SMILES | COC1CCN(C(/C=C(\N)c2ccccc2O)=C(N)N)CC1c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H28N4O4/c1-31-21-10-11-27(13-17(21)14-6-8-15(9-7-14)23(29)30)19(22(25)26)12-18(24)16-4-2-3-5-20(16)28/h2-9,12,17,21,28H,10-11,13,24-26H2,1H3,(H,29,30)/b18-12- |
| InChIKey | SMGSJKCGYSPQPW-PDGQHHTCSA-N |
| XLogP | 1.98 |
| TPSA | 148.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|