C25H29N5O3 — CID 176562694
ethyl 3-cyano-4-[1-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]piperidin-3-yl]benzoate (PubChem CID 176562694) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is ethyl 3-cyano-4-[1-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]piperidin-3-yl]benzoate.
| Compound Name | ethyl 3-cyano-4-[1-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]piperidin-3-yl]benzoate |
|---|---|
| PubChem CID | 176562694 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | ethyl 3-cyano-4-[1-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]piperidin-3-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(C2CCCN(C(/C=C(\N)c3ccccc3O)=C(N)N)C2)c(C#N)c1 |
| InChI | InChI=1S/C25H29N5O3/c1-2-33-25(32)16-9-10-19(18(12-16)14-26)17-6-5-11-30(15-17)22(24(28)29)13-21(27)20-7-3-4-8-23(20)31/h3-4,7-10,12-13,17,31H,2,5-6,11,15,27-29H2,1H3/b21-13- |
| InChIKey | BJIYMJGOUIHLBE-BKUYFWCQSA-N |
| XLogP | 2.71 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|