C22H25ClN4O4 — CID 176563083
2-chloro-4-[6-methyl-4-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]morpholin-2-yl]benzoic acid (PubChem CID 176563083) has the molecular formula C22H25ClN4O4 and a molecular weight of 444.92 g/mol. Its IUPAC name is 2-chloro-4-[6-methyl-4-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]morpholin-2-yl]benzoic acid.
| Compound Name | 2-chloro-4-[6-methyl-4-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]morpholin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 176563083 |
| Molecular Formula | C22H25ClN4O4 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-chloro-4-[6-methyl-4-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]morpholin-2-yl]benzoic acid |
| SMILES | CC1CN(C(/C=C(\N)c2ccccc2O)=C(N)N)CC(c2ccc(C(=O)O)c(Cl)c2)O1 |
| InChI | InChI=1S/C22H25ClN4O4/c1-12-10-27(11-20(31-12)13-6-7-14(22(29)30)16(23)8-13)18(21(25)26)9-17(24)15-4-2-3-5-19(15)28/h2-9,12,20,28H,10-11,24-26H2,1H3,(H,29,30)/b17-9- |
| InChIKey | KHIFTECUSFURCP-MFOYZWKCSA-N |
| XLogP | 2.59 |
| TPSA | 148.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|