C22H27N5O — CID 145145514
2-[(1Z)-1,4,4-triamino-3-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)buta-1,3-dienyl]phenol (PubChem CID 145145514) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-[(1Z)-1,4,4-triamino-3-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)buta-1,3-dienyl]phenol.
| Compound Name | 2-[(1Z)-1,4,4-triamino-3-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)buta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 145145514 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 2-[(1Z)-1,4,4-triamino-3-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)buta-1,3-dienyl]phenol |
| SMILES | NC(N)=C(/C=C(\N)c1ccccc1O)N1CC2CC1CN2Cc1ccccc1 |
| InChI | InChI=1S/C22H27N5O/c23-19(18-8-4-5-9-21(18)28)11-20(22(24)25)27-14-16-10-17(27)13-26(16)12-15-6-2-1-3-7-15/h1-9,11,16-17,28H,10,12-14,23-25H2/b19-11- |
| InChIKey | PBIMIFCWFHDNON-ODLFYWEKSA-N |
| XLogP | 1.74 |
| TPSA | 104.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|