C26H40N8O — CID 153390572
2-[(1Z)-1,4,4-triamino-3-[3,5-diethyl-4-[5-[3-(methylamino)propyl]pyrimidin-2-yl]piperazin-1-yl]buta-1,3-dienyl]phenol (PubChem CID 153390572) has the molecular formula C26H40N8O and a molecular weight of 480.66 g/mol. Its IUPAC name is 2-[(1Z)-1,4,4-triamino-3-[3,5-diethyl-4-[5-[3-(methylamino)propyl]pyrimidin-2-yl]piperazin-1-yl]buta-1,3-dienyl]phenol.
| Compound Name | 2-[(1Z)-1,4,4-triamino-3-[3,5-diethyl-4-[5-[3-(methylamino)propyl]pyrimidin-2-yl]piperazin-1-yl]buta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 153390572 |
| Molecular Formula | C26H40N8O |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.33 |
| IUPAC Name | 2-[(1Z)-1,4,4-triamino-3-[3,5-diethyl-4-[5-[3-(methylamino)propyl]pyrimidin-2-yl]piperazin-1-yl]buta-1,3-dienyl]phenol |
| SMILES | CCC1CN(C(/C=C(\N)c2ccccc2O)=C(N)N)CC(CC)N1c1ncc(CCCNC)cn1 |
| InChI | InChI=1S/C26H40N8O/c1-4-19-16-33(23(25(28)29)13-22(27)21-10-6-7-11-24(21)35)17-20(5-2)34(19)26-31-14-18(15-32-26)9-8-12-30-3/h6-7,10-11,13-15,19-20,30,35H,4-5,8-9,12,16-17,27-29H2,1-3H3/b22-13- |
| InChIKey | RNRHTGQHDONKGO-XKZIYDEJSA-N |
| XLogP | 2.10 |
| TPSA | 142.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|