C12H18O2 — CID 144669716
3-ethoxy-5-ethyl-2-methoxycyclohepta-1,3,5-triene (PubChem CID 144669716) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 3-ethoxy-5-ethyl-2-methoxycyclohepta-1,3,5-triene.
| Compound Name | 3-ethoxy-5-ethyl-2-methoxycyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 144669716 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 3-ethoxy-5-ethyl-2-methoxycyclohepta-1,3,5-triene |
| SMILES | CCOC1=CC(CC)=CCC=C1OC |
| InChI | InChI=1S/C12H18O2/c1-4-10-7-6-8-11(13-3)12(9-10)14-5-2/h7-9H,4-6H2,1-3H3 |
| InChIKey | PWGOXJAVHGFLHV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |