About 3-ethoxy-5-ethyl-2-methoxycyclohepta-1,3,5-triene
3-ethoxy-5-ethyl-2-methoxycyclohepta-1,3,5-triene (PubChem CID 144669716) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 3-ethoxy-5-ethyl-2-methoxycyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | 3-ethoxy-5-ethyl-2-methoxycyclohepta-1,3,5-triene |
| PubChem CID | 144669716 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 3-ethoxy-5-ethyl-2-methoxycyclohepta-1,3,5-triene |
| SMILES | CCOC1=CC(CC)=CCC=C1OC |
| InChI | InChI=1S/C12H18O2/c1-4-10-7-6-8-11(13-3)12(9-10)14-5-2/h7-9H,4-6H2,1-3H3 |
| InChIKey | PWGOXJAVHGFLHV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethoxy-5-ethyl-2-methoxycyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-5-ethyl-2-methoxycyclohepta-1,3,5-triene?
The IUPAC name of 3-ethoxy-5-ethyl-2-methoxycyclohepta-1,3,5-triene (CID 144669716) is 3-ethoxy-5-ethyl-2-methoxycyclohepta-1,3,5-triene.
What is the SMILES notation for 3-ethoxy-5-ethyl-2-methoxycyclohepta-1,3,5-triene?
The canonical SMILES for 3-ethoxy-5-ethyl-2-methoxycyclohepta-1,3,5-triene is CCOC1=CC(CC)=CCC=C1OC.
What is the InChIKey of 3-ethoxy-5-ethyl-2-methoxycyclohepta-1,3,5-triene?
The InChIKey is PWGOXJAVHGFLHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-4-10-7-6-8-11(13-3)12(9-10)14-5-2/h7-9H,4-6H2,1-3H3.
What are the key properties of 3-ethoxy-5-ethyl-2-methoxycyclohepta-1,3,5-triene?
3-ethoxy-5-ethyl-2-methoxycyclohepta-1,3,5-triene has a molecular weight of 194.27 g/mol, XLogP of 3.18, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-5-ethyl-2-methoxycyclohepta-1,3,5-triene is sourced from PubChem (CID 144669716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).