C10H12O5S — CID 53445295
ethyl 6-methoxy-3-sulfonylcyclohexa-1,5-diene-1-carboxylate (PubChem CID 53445295) has the molecular formula C10H12O5S and a molecular weight of 244.27 g/mol. Its IUPAC name is ethyl 6-methoxy-3-sulfonylcyclohexa-1,5-diene-1-carboxylate.
| Compound Name | ethyl 6-methoxy-3-sulfonylcyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 53445295 |
| Molecular Formula | C10H12O5S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | ethyl 6-methoxy-3-sulfonylcyclohexa-1,5-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=CC(=S(=O)=O)CC=C1OC |
| InChI | InChI=1S/C10H12O5S/c1-3-15-10(11)8-6-7(16(12)13)4-5-9(8)14-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | DLGFAUDTFCKARA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|