C16H27N — CID 143345765
N-[(1E,4Z)-2,6-diethylcycloocta-1,4,6-trien-1-yl]ethanimine;ethane (PubChem CID 143345765) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is N-[(1E,4Z)-2,6-diethylcycloocta-1,4,6-trien-1-yl]ethanimine;ethane.
| Compound Name | N-[(1E,4Z)-2,6-diethylcycloocta-1,4,6-trien-1-yl]ethanimine;ethane |
|---|---|
| PubChem CID | 143345765 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | N-[(1E,4Z)-2,6-diethylcycloocta-1,4,6-trien-1-yl]ethanimine;ethane |
| SMILES | C/C=N/C1=C(\CC)C/C=C\C(CC)=CC1.CC |
| InChI | InChI=1S/C14H21N.C2H6/c1-4-12-8-7-9-13(5-2)14(11-10-12)15-6-3;1-2/h6-8,10H,4-5,9,11H2,1-3H3;1-2H3/b8-7-,12-10?,14-13+,15-6+; |
| InChIKey | PNLPDSZOWOLZGW-LPXHXLDFSA-N |
| XLogP | 5.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|