C14H21N — CID 143345371
ethane;6-ethyl-2-methyl-3,8-dihydrocyclohepta[b]pyrrole (PubChem CID 143345371) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is ethane;6-ethyl-2-methyl-3,8-dihydrocyclohepta[b]pyrrole.
| Compound Name | ethane;6-ethyl-2-methyl-3,8-dihydrocyclohepta[b]pyrrole |
|---|---|
| PubChem CID | 143345371 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | ethane;6-ethyl-2-methyl-3,8-dihydrocyclohepta[b]pyrrole |
| SMILES | CC.CCC1=CCC2=C(C=C1)CC(C)=N2 |
| InChI | InChI=1S/C12H15N.C2H6/c1-3-10-4-6-11-8-9(2)13-12(11)7-5-10;1-2/h4-6H,3,7-8H2,1-2H3;1-2H3 |
| InChIKey | ZDINVBBQJQOTAU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |