C11H15N — CID 178128673
N-(7-ethylcyclohepta-1,3,6-trien-1-yl)ethanimine (PubChem CID 178128673) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is N-(7-ethylcyclohepta-1,3,6-trien-1-yl)ethanimine.
| Compound Name | N-(7-ethylcyclohepta-1,3,6-trien-1-yl)ethanimine |
|---|---|
| PubChem CID | 178128673 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | N-(7-ethylcyclohepta-1,3,6-trien-1-yl)ethanimine |
| SMILES | C/C=N/C1=CC=CCC=C1CC |
| InChI | InChI=1S/C11H15N/c1-3-10-8-6-5-7-9-11(10)12-4-2/h4-5,7-9H,3,6H2,1-2H3/b12-4+ |
| InChIKey | ZSICCXNISCBXLQ-UUILKARUSA-N |
| XLogP | 3.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|