About 7-ethyl-N,N-dimethylcyclohepta-1,4,6-trien-1-amine
7-ethyl-N,N-dimethylcyclohepta-1,4,6-trien-1-amine (PubChem CID 162765206) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 7-ethyl-N,N-dimethylcyclohepta-1,4,6-trien-1-amine.
Analyze 7-ethyl-N,N-dimethylcyclohepta-1,4,6-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-N,N-dimethylcyclohepta-1,4,6-trien-1-amine?
The IUPAC name of 7-ethyl-N,N-dimethylcyclohepta-1,4,6-trien-1-amine (CID 162765206) is 7-ethyl-N,N-dimethylcyclohepta-1,4,6-trien-1-amine.
What is the SMILES notation for 7-ethyl-N,N-dimethylcyclohepta-1,4,6-trien-1-amine?
The canonical SMILES for 7-ethyl-N,N-dimethylcyclohepta-1,4,6-trien-1-amine is CCC1=CC=CCC=C1N(C)C.
What is the InChIKey of 7-ethyl-N,N-dimethylcyclohepta-1,4,6-trien-1-amine?
The InChIKey is GEDYMJMLKZTPQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-4-10-8-6-5-7-9-11(10)12(2)3/h5-6,8-9H,4,7H2,1-3H3.
What are the key properties of 7-ethyl-N,N-dimethylcyclohepta-1,4,6-trien-1-amine?
7-ethyl-N,N-dimethylcyclohepta-1,4,6-trien-1-amine has a molecular weight of 163.26 g/mol, XLogP of 2.73, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-N,N-dimethylcyclohepta-1,4,6-trien-1-amine is sourced from PubChem (CID 162765206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).