About 1-(7-fluorocyclohepta-1,3,6-trien-1-yl)-N-methylmethanamine
1-(7-fluorocyclohepta-1,3,6-trien-1-yl)-N-methylmethanamine (PubChem CID 142050488) has the molecular formula C9H12FN
and a molecular weight of 153.20 g/mol. Its IUPAC name is 1-(7-fluorocyclohepta-1,3,6-trien-1-yl)-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-(7-fluorocyclohepta-1,3,6-trien-1-yl)-N-methylmethanamine |
| PubChem CID | 142050488 |
| Molecular Formula | C9H12FN |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 1-(7-fluorocyclohepta-1,3,6-trien-1-yl)-N-methylmethanamine |
| SMILES | CNCC1=CC=CCC=C1F |
| InChI | InChI=1S/C9H12FN/c1-11-7-8-5-3-2-4-6-9(8)10/h2-3,5-6,11H,4,7H2,1H3 |
| InChIKey | JRHKMLHXBLIJMO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(7-fluorocyclohepta-1,3,6-trien-1-yl)-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-fluorocyclohepta-1,3,6-trien-1-yl)-N-methylmethanamine?
The IUPAC name of 1-(7-fluorocyclohepta-1,3,6-trien-1-yl)-N-methylmethanamine (CID 142050488) is 1-(7-fluorocyclohepta-1,3,6-trien-1-yl)-N-methylmethanamine.
What is the SMILES notation for 1-(7-fluorocyclohepta-1,3,6-trien-1-yl)-N-methylmethanamine?
The canonical SMILES for 1-(7-fluorocyclohepta-1,3,6-trien-1-yl)-N-methylmethanamine is CNCC1=CC=CCC=C1F.
What is the InChIKey of 1-(7-fluorocyclohepta-1,3,6-trien-1-yl)-N-methylmethanamine?
The InChIKey is JRHKMLHXBLIJMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FN/c1-11-7-8-5-3-2-4-6-9(8)10/h2-3,5-6,11H,4,7H2,1H3.
What are the key properties of 1-(7-fluorocyclohepta-1,3,6-trien-1-yl)-N-methylmethanamine?
1-(7-fluorocyclohepta-1,3,6-trien-1-yl)-N-methylmethanamine has a molecular weight of 153.20 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-fluorocyclohepta-1,3,6-trien-1-yl)-N-methylmethanamine is sourced from PubChem (CID 142050488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).