C16H23N — CID 144983882
ethane;(Z)-N-[7-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-yl]but-2-en-1-imine (PubChem CID 144983882) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is ethane;(Z)-N-[7-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-yl]but-2-en-1-imine.
| Compound Name | ethane;(Z)-N-[7-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 144983882 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | ethane;(Z)-N-[7-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-yl]but-2-en-1-imine |
| SMILES | C/C=C\C=N\C1=CCC=CC=C1/C=C/C.CC |
| InChI | InChI=1S/C14H17N.C2H6/c1-3-5-12-15-14-11-8-6-7-10-13(14)9-4-2;1-2/h3-7,9-12H,8H2,1-2H3;1-2H3/b5-3-,9-4+,15-12+; |
| InChIKey | VKXKNZGBSBLAFO-AVXVAMKWSA-N |
| XLogP | 5.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|