C10H12O — CID 142173984
(6E)-6-[(Z)-but-2-enylidene]cyclohexa-1,3-dien-1-ol (PubChem CID 142173984) has the molecular formula C10H12O and a molecular weight of 148.20 g/mol. Its IUPAC name is (6E)-6-[(Z)-but-2-enylidene]cyclohexa-1,3-dien-1-ol.
| Compound Name | (6E)-6-[(Z)-but-2-enylidene]cyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 142173984 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | (6E)-6-[(Z)-but-2-enylidene]cyclohexa-1,3-dien-1-ol |
| SMILES | C/C=C\C=C1/CC=CC=C1O |
| InChI | InChI=1S/C10H12O/c1-2-3-6-9-7-4-5-8-10(9)11/h2-6,8,11H,7H2,1H3/b3-2-,9-6+ |
| InChIKey | XHLSWGRKVDTCNY-NRNOEJAFSA-N |
| XLogP | 2.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |