C16H20 — CID 143829874
ethane;3-[(1Z,3Z)-penta-1,3-dienyl]-1H-indene (PubChem CID 143829874) has the molecular formula C16H20 and a molecular weight of 212.34 g/mol. Its IUPAC name is ethane;3-[(1Z,3Z)-penta-1,3-dienyl]-1H-indene.
| Compound Name | ethane;3-[(1Z,3Z)-penta-1,3-dienyl]-1H-indene |
|---|---|
| PubChem CID | 143829874 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | ethane;3-[(1Z,3Z)-penta-1,3-dienyl]-1H-indene |
| SMILES | C/C=C\C=C/C1=CCc2ccccc21.CC |
| InChI | InChI=1S/C14H14.C2H6/c1-2-3-4-7-12-10-11-13-8-5-6-9-14(12)13;1-2/h2-10H,11H2,1H3;1-2H3/b3-2-,7-4-; |
| InChIKey | XKJIFTPHFVDWJK-YBWDWWGFSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|