About ethane;3-methyl-1H-indene
ethane;3-methyl-1H-indene (PubChem CID 90920725) has the molecular formula C12H16
and a molecular weight of 160.26 g/mol. Its IUPAC name is ethane;3-methyl-1H-indene.
Molecular Properties
| Compound Name | ethane;3-methyl-1H-indene |
| PubChem CID | 90920725 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | ethane;3-methyl-1H-indene |
| SMILES | CC.CC1=CCc2ccccc21 |
| InChI | InChI=1S/C10H10.C2H6/c1-8-6-7-9-4-2-3-5-10(8)9;1-2/h2-6H,7H2,1H3;1-2H3 |
| InChIKey | FJCDTPWHBPCMOS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;3-methyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-1H-indene?
The IUPAC name of ethane;3-methyl-1H-indene (CID 90920725) is ethane;3-methyl-1H-indene.
What is the SMILES notation for ethane;3-methyl-1H-indene?
The canonical SMILES for ethane;3-methyl-1H-indene is CC.CC1=CCc2ccccc21.
What is the InChIKey of ethane;3-methyl-1H-indene?
The InChIKey is FJCDTPWHBPCMOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10.C2H6/c1-8-6-7-9-4-2-3-5-10(8)9;1-2/h2-6H,7H2,1H3;1-2H3.
What are the key properties of ethane;3-methyl-1H-indene?
ethane;3-methyl-1H-indene has a molecular weight of 160.26 g/mol, XLogP of 3.67, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-1H-indene is sourced from PubChem (CID 90920725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).