C13H14 — CID 142104722
6,7-dimethyl-9H-benzo[7]annulene (PubChem CID 142104722) has the molecular formula C13H14 and a molecular weight of 170.25 g/mol. Its IUPAC name is 6,7-dimethyl-9H-benzo[7]annulene.
| Compound Name | 6,7-dimethyl-9H-benzo[7]annulene |
|---|---|
| PubChem CID | 142104722 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 6,7-dimethyl-9H-benzo[7]annulene |
| SMILES | CC1=CCc2ccccc2C=C1C |
| InChI | InChI=1S/C13H14/c1-10-7-8-12-5-3-4-6-13(12)9-11(10)2/h3-7,9H,8H2,1-2H3 |
| InChIKey | PMSFTLRBGNRHON-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |