About ethane;1-(3H-inden-1-yl)ethanol;methane
ethane;1-(3H-inden-1-yl)ethanol;methane (PubChem CID 159608364) has the molecular formula C16H28O
and a molecular weight of 236.40 g/mol. Its IUPAC name is ethane;1-(3H-inden-1-yl)ethanol;methane.
Molecular Properties
| Compound Name | ethane;1-(3H-inden-1-yl)ethanol;methane |
| PubChem CID | 159608364 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | ethane;1-(3H-inden-1-yl)ethanol;methane |
| SMILES | C.CC.CC.CC(O)C1=CCc2ccccc21 |
| InChI | InChI=1S/C11H12O.2C2H6.CH4/c1-8(12)10-7-6-9-4-2-3-5-11(9)10;2*1-2;/h2-5,7-8,12H,6H2,1H3;2*1-2H3;1H4 |
| InChIKey | MMJCBKBITIZHJR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-(3H-inden-1-yl)ethanol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(3H-inden-1-yl)ethanol;methane?
The IUPAC name of ethane;1-(3H-inden-1-yl)ethanol;methane (CID 159608364) is ethane;1-(3H-inden-1-yl)ethanol;methane.
What is the SMILES notation for ethane;1-(3H-inden-1-yl)ethanol;methane?
The canonical SMILES for ethane;1-(3H-inden-1-yl)ethanol;methane is C.CC.CC.CC(O)C1=CCc2ccccc21.
What is the InChIKey of ethane;1-(3H-inden-1-yl)ethanol;methane?
The InChIKey is MMJCBKBITIZHJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O.2C2H6.CH4/c1-8(12)10-7-6-9-4-2-3-5-11(9)10;2*1-2;/h2-5,7-8,12H,6H2,1H3;2*1-2H3;1H4.
What are the key properties of ethane;1-(3H-inden-1-yl)ethanol;methane?
ethane;1-(3H-inden-1-yl)ethanol;methane has a molecular weight of 236.40 g/mol, XLogP of 4.70, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(3H-inden-1-yl)ethanol;methane is sourced from PubChem (CID 159608364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).