C25H36N2 — CID 155718706
1-[(2E)-3,12-dimethyl-2-tricyclo[11.4.0.04,9]heptadeca-1(17),2,4,6,8,11,13,15-octaenyl]-1,2-dimethylhydrazine;ethane (PubChem CID 155718706) has the molecular formula C25H36N2 and a molecular weight of 364.58 g/mol. Its IUPAC name is 1-[(2E)-3,12-dimethyl-2-tricyclo[11.4.0.04,9]heptadeca-1(17),2,4,6,8,11,13,15-octaenyl]-1,2-dimethylhydrazine;ethane.
| Compound Name | 1-[(2E)-3,12-dimethyl-2-tricyclo[11.4.0.04,9]heptadeca-1(17),2,4,6,8,11,13,15-octaenyl]-1,2-dimethylhydrazine;ethane |
|---|---|
| PubChem CID | 155718706 |
| Molecular Formula | C25H36N2 |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.29 |
| IUPAC Name | 1-[(2E)-3,12-dimethyl-2-tricyclo[11.4.0.04,9]heptadeca-1(17),2,4,6,8,11,13,15-octaenyl]-1,2-dimethylhydrazine;ethane |
| SMILES | CC.CC.CNN(C)/C1=C(\C)c2ccccc2CC=C(C)c2ccccc21 |
| InChI | InChI=1S/C21H24N2.2C2H6/c1-15-13-14-17-9-5-6-11-19(17)16(2)21(23(4)22-3)20-12-8-7-10-18(15)20;2*1-2/h5-13,22H,14H2,1-4H3;2*1-2H3/b15-13?,21-16+;; |
| InChIKey | DFFADMDGCMGGRV-XTVWFJLUSA-N |
| XLogP | 6.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|