C12H15N — CID 20658444
1-(3H-inden-1-yl)-N,N-dimethylmethanamine (PubChem CID 20658444) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 1-(3H-inden-1-yl)-N,N-dimethylmethanamine.
| Compound Name | 1-(3H-inden-1-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 20658444 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 1-(3H-inden-1-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1=CCc2ccccc21 |
| InChI | InChI=1S/C12H15N/c1-13(2)9-11-8-7-10-5-3-4-6-12(10)11/h3-6,8H,7,9H2,1-2H3 |
| InChIKey | SSLHXZSPWIDYRF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |