C18H32O2 — CID 142062038
ethane;(7-methylcyclohepta-1,3,6-trien-1-yl) (Z)-but-2-enoate (PubChem CID 142062038) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is ethane;(7-methylcyclohepta-1,3,6-trien-1-yl) (Z)-but-2-enoate.
| Compound Name | ethane;(7-methylcyclohepta-1,3,6-trien-1-yl) (Z)-but-2-enoate |
|---|---|
| PubChem CID | 142062038 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | ethane;(7-methylcyclohepta-1,3,6-trien-1-yl) (Z)-but-2-enoate |
| SMILES | C/C=C\C(=O)OC1=CC=CCC=C1C.CC.CC.CC |
| InChI | InChI=1S/C12H14O2.3C2H6/c1-3-7-12(13)14-11-9-6-4-5-8-10(11)2;3*1-2/h3-4,6-9H,5H2,1-2H3;3*1-2H3/b7-3-;;; |
| InChIKey | OHINYEAVZAOVPV-RZBDIMBASA-N |
| XLogP | 5.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|