C12H14O2 — CID 145320664
cyclohexa-1,3-dien-1-yl (2E,4E)-hexa-2,4-dienoate (PubChem CID 145320664) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is cyclohexa-1,3-dien-1-yl (2E,4E)-hexa-2,4-dienoate.
| Compound Name | cyclohexa-1,3-dien-1-yl (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 145320664 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | cyclohexa-1,3-dien-1-yl (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)OC1=CC=CCC1 |
| InChI | InChI=1S/C12H14O2/c1-2-3-5-10-12(13)14-11-8-6-4-7-9-11/h2-6,8,10H,7,9H2,1H3/b3-2+,10-5+ |
| InChIKey | CHFNTFZDIBIWRY-XPQLPGEHSA-N |
| XLogP | 2.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|