C20H18O4 — CID 72829602
[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenyl] hexa-2,4-dienoate (PubChem CID 72829602) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is [4-[2-(3,5-dihydroxyphenyl)ethenyl]phenyl] hexa-2,4-dienoate.
| Compound Name | [4-[2-(3,5-dihydroxyphenyl)ethenyl]phenyl] hexa-2,4-dienoate |
|---|---|
| PubChem CID | 72829602 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | [4-[2-(3,5-dihydroxyphenyl)ethenyl]phenyl] hexa-2,4-dienoate |
| SMILES | CC=CC=CC(=O)Oc1ccc(C=Cc2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C20H18O4/c1-2-3-4-5-20(23)24-19-10-8-15(9-11-19)6-7-16-12-17(21)14-18(22)13-16/h2-14,21-22H,1H3 |
| InChIKey | BQQFDDCFBFMUCT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|