C13H20N4 — CID 142229617
N,N-dimethyl-N'-[N'-(7-methylcyclohepta-1,3,6-trien-1-yl)carbamimidoyl]ethanimidamide (PubChem CID 142229617) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is N,N-dimethyl-N'-[N'-(7-methylcyclohepta-1,3,6-trien-1-yl)carbamimidoyl]ethanimidamide.
| Compound Name | N,N-dimethyl-N'-[N'-(7-methylcyclohepta-1,3,6-trien-1-yl)carbamimidoyl]ethanimidamide |
|---|---|
| PubChem CID | 142229617 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | N,N-dimethyl-N'-[N'-(7-methylcyclohepta-1,3,6-trien-1-yl)carbamimidoyl]ethanimidamide |
| SMILES | CC1=CCC=CC=C1/N=C(N)/N=C(\C)N(C)C |
| InChI | InChI=1S/C13H20N4/c1-10-8-6-5-7-9-12(10)16-13(14)15-11(2)17(3)4/h5,7-9H,6H2,1-4H3,(H2,14,16)/b15-11+ |
| InChIKey | MUZVPOGXWBNNTM-RVDMUPIBSA-N |
| XLogP | 2.07 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|