About ethane;1-methoxy-2-methylpropane;2-methyl-3-propan-2-ylcyclohepta-1,3,5-triene
ethane;1-methoxy-2-methylpropane;2-methyl-3-propan-2-ylcyclohepta-1,3,5-triene (PubChem CID 143413618) has the molecular formula C18H34O
and a molecular weight of 266.47 g/mol. Its IUPAC name is ethane;1-methoxy-2-methylpropane;2-methyl-3-propan-2-ylcyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | ethane;1-methoxy-2-methylpropane;2-methyl-3-propan-2-ylcyclohepta-1,3,5-triene |
| PubChem CID | 143413618 |
| Molecular Formula | C18H34O |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.26 |
| IUPAC Name | ethane;1-methoxy-2-methylpropane;2-methyl-3-propan-2-ylcyclohepta-1,3,5-triene |
| SMILES | CC.CC1=CCC=CC=C1C(C)C.COCC(C)C |
| InChI | InChI=1S/C11H16.C5H12O.C2H6/c1-9(2)11-8-6-4-5-7-10(11)3;1-5(2)4-6-3;1-2/h4,6-9H,5H2,1-3H3;5H,4H2,1-3H3;1-2H3 |
| InChIKey | KJSZVTKAUWBNGB-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-methoxy-2-methylpropane;2-methyl-3-propan-2-ylcyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methoxy-2-methylpropane;2-methyl-3-propan-2-ylcyclohepta-1,3,5-triene?
The IUPAC name of ethane;1-methoxy-2-methylpropane;2-methyl-3-propan-2-ylcyclohepta-1,3,5-triene (CID 143413618) is ethane;1-methoxy-2-methylpropane;2-methyl-3-propan-2-ylcyclohepta-1,3,5-triene.
What is the SMILES notation for ethane;1-methoxy-2-methylpropane;2-methyl-3-propan-2-ylcyclohepta-1,3,5-triene?
The canonical SMILES for ethane;1-methoxy-2-methylpropane;2-methyl-3-propan-2-ylcyclohepta-1,3,5-triene is CC.CC1=CCC=CC=C1C(C)C.COCC(C)C.
What is the InChIKey of ethane;1-methoxy-2-methylpropane;2-methyl-3-propan-2-ylcyclohepta-1,3,5-triene?
The InChIKey is KJSZVTKAUWBNGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16.C5H12O.C2H6/c1-9(2)11-8-6-4-5-7-10(11)3;1-5(2)4-6-3;1-2/h4,6-9H,5H2,1-3H3;5H,4H2,1-3H3;1-2H3.
What are the key properties of ethane;1-methoxy-2-methylpropane;2-methyl-3-propan-2-ylcyclohepta-1,3,5-triene?
ethane;1-methoxy-2-methylpropane;2-methyl-3-propan-2-ylcyclohepta-1,3,5-triene has a molecular weight of 266.47 g/mol, XLogP of 5.79, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methoxy-2-methylpropane;2-methyl-3-propan-2-ylcyclohepta-1,3,5-triene is sourced from PubChem (CID 143413618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).