C9H14O2 — CID 173164220
1-cyclohexa-1,3-dien-1-yl-2-methoxyethanol (PubChem CID 173164220) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-yl-2-methoxyethanol.
| Compound Name | 1-cyclohexa-1,3-dien-1-yl-2-methoxyethanol |
|---|---|
| PubChem CID | 173164220 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-yl-2-methoxyethanol |
| SMILES | COCC(O)C1=CC=CCC1 |
| InChI | InChI=1S/C9H14O2/c1-11-7-9(10)8-5-3-2-4-6-8/h2-3,5,9-10H,4,6-7H2,1H3 |
| InChIKey | DLQZHXXXNDEVTL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |