C22H30ClNO3 — CID 67113834
N-benzyl-2-chloro-N-(2-cyclohexa-1,3-dien-1-yl-3-hydroxy-4-propoxybutyl)acetamide (PubChem CID 67113834) has the molecular formula C22H30ClNO3 and a molecular weight of 391.94 g/mol. Its IUPAC name is N-benzyl-2-chloro-N-(2-cyclohexa-1,3-dien-1-yl-3-hydroxy-4-propoxybutyl)acetamide.
| Compound Name | N-benzyl-2-chloro-N-(2-cyclohexa-1,3-dien-1-yl-3-hydroxy-4-propoxybutyl)acetamide |
|---|---|
| PubChem CID | 67113834 |
| Molecular Formula | C22H30ClNO3 |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-benzyl-2-chloro-N-(2-cyclohexa-1,3-dien-1-yl-3-hydroxy-4-propoxybutyl)acetamide |
| SMILES | CCCOCC(O)C(CN(Cc1ccccc1)C(=O)CCl)C1=CC=CCC1 |
| InChI | InChI=1S/C22H30ClNO3/c1-2-13-27-17-21(25)20(19-11-7-4-8-12-19)16-24(22(26)14-23)15-18-9-5-3-6-10-18/h3-7,9-11,20-21,25H,2,8,12-17H2,1H3 |
| InChIKey | XLVUOUANZRNEHD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|