C24H38ClNO2 — CID 45125156
1-[2-(1-adamantyl)ethoxy]-3-[benzyl(ethyl)amino]propan-2-ol;hydrochloride (PubChem CID 45125156) has the molecular formula C24H38ClNO2 and a molecular weight of 408.03 g/mol. Its IUPAC name is 1-[2-(1-adamantyl)ethoxy]-3-[benzyl(ethyl)amino]propan-2-ol;hydrochloride.
| Compound Name | 1-[2-(1-adamantyl)ethoxy]-3-[benzyl(ethyl)amino]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 45125156 |
| Molecular Formula | C24H38ClNO2 |
| Molecular Weight | 408.03 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 1-[2-(1-adamantyl)ethoxy]-3-[benzyl(ethyl)amino]propan-2-ol;hydrochloride |
| SMILES | CCN(Cc1ccccc1)CC(O)COCCC12CC3CC(CC(C3)C1)C2.Cl |
| InChI | InChI=1S/C24H37NO2.ClH/c1-2-25(16-19-6-4-3-5-7-19)17-23(26)18-27-9-8-24-13-20-10-21(14-24)12-22(11-20)15-24;/h3-7,20-23,26H,2,8-18H2,1H3;1H |
| InChIKey | GWCUWNYJFUHHEX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.03 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|