C18H31NO4 — CID 3838159
1-[benzyl(2,2-diethoxyethyl)amino]-3-ethoxypropan-2-ol (PubChem CID 3838159) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is 1-[benzyl(2,2-diethoxyethyl)amino]-3-ethoxypropan-2-ol.
| Compound Name | 1-[benzyl(2,2-diethoxyethyl)amino]-3-ethoxypropan-2-ol |
|---|---|
| PubChem CID | 3838159 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | 1-[benzyl(2,2-diethoxyethyl)amino]-3-ethoxypropan-2-ol |
| SMILES | CCOCC(O)CN(Cc1ccccc1)CC(OCC)OCC |
| InChI | InChI=1S/C18H31NO4/c1-4-21-15-17(20)13-19(12-16-10-8-7-9-11-16)14-18(22-5-2)23-6-3/h7-11,17-18,20H,4-6,12-15H2,1-3H3 |
| InChIKey | IYJZGMPHHSHQMN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|