C21H40N2O2+2 — CID 7482017
(2S)-1-[2-(1-adamantyl)ethoxy]-3-(4-ethylpiperazine-1,4-diium-1-yl)propan-2-ol (PubChem CID 7482017) has the molecular formula C21H40N2O2+2 and a molecular weight of 352.56 g/mol. Its IUPAC name is (2S)-1-[2-(1-adamantyl)ethoxy]-3-(4-ethylpiperazine-1,4-diium-1-yl)propan-2-ol.
| Compound Name | (2S)-1-[2-(1-adamantyl)ethoxy]-3-(4-ethylpiperazine-1,4-diium-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 7482017 |
| Molecular Formula | C21H40N2O2+2 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.31 |
| IUPAC Name | (2S)-1-[2-(1-adamantyl)ethoxy]-3-(4-ethylpiperazine-1,4-diium-1-yl)propan-2-ol |
| SMILES | CC[NH+]1CC[NH+](C[C@H](O)COCCC23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C21H38N2O2/c1-2-22-4-6-23(7-5-22)15-20(24)16-25-8-3-21-12-17-9-18(13-21)11-19(10-17)14-21/h17-20,24H,2-16H2,1H3/p+2/t17?,18?,19?,20-,21?/m0/s1 |
| InChIKey | RHWOLUBHHZKDCJ-KGMASTOKSA-P |
| XLogP | -0.23 |
| TPSA | 38.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|