C22H39NO2 — CID 42443395
(2R)-1-[2-(1-adamantyl)ethoxy]-3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-ol (PubChem CID 42443395) has the molecular formula C22H39NO2 and a molecular weight of 349.56 g/mol. Its IUPAC name is (2R)-1-[2-(1-adamantyl)ethoxy]-3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[2-(1-adamantyl)ethoxy]-3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 42443395 |
| Molecular Formula | C22H39NO2 |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.30 |
| IUPAC Name | (2R)-1-[2-(1-adamantyl)ethoxy]-3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-ol |
| SMILES | C[C@@H]1C[C@@H](C)CN(C[C@@H](O)COCCC23CC4CC(CC(C4)C2)C3)C1 |
| InChI | InChI=1S/C22H39NO2/c1-16-5-17(2)13-23(12-16)14-21(24)15-25-4-3-22-9-18-6-19(10-22)8-20(7-18)11-22/h16-21,24H,3-15H2,1-2H3/t16-,17-,18?,19?,20?,21-,22?/m1/s1 |
| InChIKey | VTOTZHZPJYFTJL-OWFIIGRXSA-N |
| XLogP | 3.95 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|