C26H40N2O3 — CID 7070606
(2R)-1-[2-(1-adamantyl)ethoxy]-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol (PubChem CID 7070606) has the molecular formula C26H40N2O3 and a molecular weight of 428.62 g/mol. Its IUPAC name is (2R)-1-[2-(1-adamantyl)ethoxy]-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[2-(1-adamantyl)ethoxy]-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 7070606 |
| Molecular Formula | C26H40N2O3 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | (2R)-1-[2-(1-adamantyl)ethoxy]-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol |
| SMILES | COc1ccc(N2CCN(C[C@@H](O)COCCC34CC5CC(CC(C5)C3)C4)CC2)cc1 |
| InChI | InChI=1S/C26H40N2O3/c1-30-25-4-2-23(3-5-25)28-9-7-27(8-10-28)18-24(29)19-31-11-6-26-15-20-12-21(16-26)14-22(13-20)17-26/h2-5,20-22,24,29H,6-19H2,1H3/t20?,21?,22?,24-,26?/m1/s1 |
| InChIKey | PDVKXDWGAREKBA-UEMNXXGQSA-N |
| XLogP | 3.80 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|