C25H37FN2O2 — CID 2770538
1-[2-(1-adamantyl)ethoxy]-3-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-ol (PubChem CID 2770538) has the molecular formula C25H37FN2O2 and a molecular weight of 416.58 g/mol. Its IUPAC name is 1-[2-(1-adamantyl)ethoxy]-3-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-ol.
| Compound Name | 1-[2-(1-adamantyl)ethoxy]-3-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 2770538 |
| Molecular Formula | C25H37FN2O2 |
| Molecular Weight | 416.58 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | 1-[2-(1-adamantyl)ethoxy]-3-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-ol |
| SMILES | OC(COCCC12CC3CC(CC(C3)C1)C2)CN1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C25H37FN2O2/c26-23-3-1-2-4-24(23)28-8-6-27(7-9-28)17-22(29)18-30-10-5-25-14-19-11-20(15-25)13-21(12-19)16-25/h1-4,19-22,29H,5-18H2 |
| InChIKey | CYPNYGZHBRYJOW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|