C21H38NO2+ — CID 7120799
(2S)-1-[2-(1-adamantyl)ethoxy]-3-[(3S)-3-methylpiperidin-1-ium-1-yl]propan-2-ol (PubChem CID 7120799) has the molecular formula C21H38NO2+ and a molecular weight of 336.54 g/mol. Its IUPAC name is (2S)-1-[2-(1-adamantyl)ethoxy]-3-[(3S)-3-methylpiperidin-1-ium-1-yl]propan-2-ol.
| Compound Name | (2S)-1-[2-(1-adamantyl)ethoxy]-3-[(3S)-3-methylpiperidin-1-ium-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 7120799 |
| Molecular Formula | C21H38NO2+ |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.29 |
| IUPAC Name | (2S)-1-[2-(1-adamantyl)ethoxy]-3-[(3S)-3-methylpiperidin-1-ium-1-yl]propan-2-ol |
| SMILES | C[C@H]1CCC[NH+](C[C@H](O)COCCC23CC4CC(CC(C4)C2)C3)C1 |
| InChI | InChI=1S/C21H37NO2/c1-16-3-2-5-22(13-16)14-20(23)15-24-6-4-21-10-17-7-18(11-21)9-19(8-17)12-21/h16-20,23H,2-15H2,1H3/p+1/t16-,17?,18?,19?,20-,21?/m0/s1 |
| InChIKey | BOXSZJJSGYKFPP-VVHWVUDUSA-O |
| XLogP | 2.29 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|