C20H36NO2+ — CID 7058426
(2S)-1-[2-(1-adamantyl)ethoxy]-3-piperidin-1-ium-1-ylpropan-2-ol (PubChem CID 7058426) has the molecular formula C20H36NO2+ and a molecular weight of 322.51 g/mol. Its IUPAC name is (2S)-1-[2-(1-adamantyl)ethoxy]-3-piperidin-1-ium-1-ylpropan-2-ol.
| Compound Name | (2S)-1-[2-(1-adamantyl)ethoxy]-3-piperidin-1-ium-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 7058426 |
| Molecular Formula | C20H36NO2+ |
| Molecular Weight | 322.51 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | (2S)-1-[2-(1-adamantyl)ethoxy]-3-piperidin-1-ium-1-ylpropan-2-ol |
| SMILES | O[C@H](COCCC12CC3CC(CC(C3)C1)C2)C[NH+]1CCCCC1 |
| InChI | InChI=1S/C20H35NO2/c22-19(14-21-5-2-1-3-6-21)15-23-7-4-20-11-16-8-17(12-20)10-18(9-16)13-20/h16-19,22H,1-15H2/p+1/t16?,17?,18?,19-,20?/m0/s1 |
| InChIKey | LHMWCEDVOVBYIR-NRFBVMONSA-O |
| XLogP | 2.04 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|