C14H19F3N2 — CID 59495611
N,N-dimethyl-N'-[3-propan-2-yl-5-(trifluoromethyl)phenyl]ethanimidamide (PubChem CID 59495611) has the molecular formula C14H19F3N2 and a molecular weight of 272.31 g/mol. Its IUPAC name is N,N-dimethyl-N'-[3-propan-2-yl-5-(trifluoromethyl)phenyl]ethanimidamide.
| Compound Name | N,N-dimethyl-N'-[3-propan-2-yl-5-(trifluoromethyl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 59495611 |
| Molecular Formula | C14H19F3N2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N,N-dimethyl-N'-[3-propan-2-yl-5-(trifluoromethyl)phenyl]ethanimidamide |
| SMILES | C/C(=N\c1cc(C(C)C)cc(C(F)(F)F)c1)N(C)C |
| InChI | InChI=1S/C14H19F3N2/c1-9(2)11-6-12(14(15,16)17)8-13(7-11)18-10(3)19(4)5/h6-9H,1-5H3/b18-10+ |
| InChIKey | AWAPBUZICBTIDC-VCHYOVAHSA-N |
| XLogP | 4.44 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|