C10H15NO — CID 143923802
cyclohepta-1,3,6-triene-1-carboxamide;ethane (PubChem CID 143923802) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is cyclohepta-1,3,6-triene-1-carboxamide;ethane.
| Compound Name | cyclohepta-1,3,6-triene-1-carboxamide;ethane |
|---|---|
| PubChem CID | 143923802 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | cyclohepta-1,3,6-triene-1-carboxamide;ethane |
| SMILES | CC.NC(=O)C1=CC=CCC=C1 |
| InChI | InChI=1S/C8H9NO.C2H6/c9-8(10)7-5-3-1-2-4-6-7;1-2/h1,3-6H,2H2,(H2,9,10);1-2H3 |
| InChIKey | DYAPVKIYFGMSSQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |