C15H22N2 — CID 91142648
N'-(1-cyclohepta-1,3,6-trien-1-ylprop-1-enyl)pentanimidamide (PubChem CID 91142648) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is N'-(1-cyclohepta-1,3,6-trien-1-ylprop-1-enyl)pentanimidamide.
| Compound Name | N'-(1-cyclohepta-1,3,6-trien-1-ylprop-1-enyl)pentanimidamide |
|---|---|
| PubChem CID | 91142648 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | N'-(1-cyclohepta-1,3,6-trien-1-ylprop-1-enyl)pentanimidamide |
| SMILES | CC=C(/N=C(/N)CCCC)C1=CC=CCC=C1 |
| InChI | InChI=1S/C15H22N2/c1-3-5-12-15(16)17-14(4-2)13-10-8-6-7-9-11-13/h4,6,8-11H,3,5,7,12H2,1-2H3,(H2,16,17) |
| InChIKey | WIAABNLSPCTJJH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|