About 5-nonan-5-ylidenecyclopenta-1,3-diene;propane;prop-1-ene
5-nonan-5-ylidenecyclopenta-1,3-diene;propane;prop-1-ene (PubChem CID 143525148) has the molecular formula C20H36
and a molecular weight of 276.51 g/mol. Its IUPAC name is 5-nonan-5-ylidenecyclopenta-1,3-diene;propane;prop-1-ene.
Molecular Properties
| Compound Name | 5-nonan-5-ylidenecyclopenta-1,3-diene;propane;prop-1-ene |
| PubChem CID | 143525148 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | 5-nonan-5-ylidenecyclopenta-1,3-diene;propane;prop-1-ene |
| SMILES | C=CC.CCC.CCCCC(CCCC)=C1C=CC=C1 |
| InChI | InChI=1S/C14H22.C3H8.C3H6/c1-3-5-9-13(10-6-4-2)14-11-7-8-12-14;2*1-3-2/h7-8,11-12H,3-6,9-10H2,1-2H3;3H2,1-2H3;3H,1H2,2H3 |
| InChIKey | FLBDVQCUABMZHR-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-nonan-5-ylidenecyclopenta-1,3-diene;propane;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nonan-5-ylidenecyclopenta-1,3-diene;propane;prop-1-ene?
The IUPAC name of 5-nonan-5-ylidenecyclopenta-1,3-diene;propane;prop-1-ene (CID 143525148) is 5-nonan-5-ylidenecyclopenta-1,3-diene;propane;prop-1-ene.
What is the SMILES notation for 5-nonan-5-ylidenecyclopenta-1,3-diene;propane;prop-1-ene?
The canonical SMILES for 5-nonan-5-ylidenecyclopenta-1,3-diene;propane;prop-1-ene is C=CC.CCC.CCCCC(CCCC)=C1C=CC=C1.
What is the InChIKey of 5-nonan-5-ylidenecyclopenta-1,3-diene;propane;prop-1-ene?
The InChIKey is FLBDVQCUABMZHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22.C3H8.C3H6/c1-3-5-9-13(10-6-4-2)14-11-7-8-12-14;2*1-3-2/h7-8,11-12H,3-6,9-10H2,1-2H3;3H2,1-2H3;3H,1H2,2H3.
What are the key properties of 5-nonan-5-ylidenecyclopenta-1,3-diene;propane;prop-1-ene?
5-nonan-5-ylidenecyclopenta-1,3-diene;propane;prop-1-ene has a molecular weight of 276.51 g/mol, XLogP of 7.40, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nonan-5-ylidenecyclopenta-1,3-diene;propane;prop-1-ene is sourced from PubChem (CID 143525148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).