About N'-aminononanimidamide
N'-aminononanimidamide (PubChem CID 4100069) has the molecular formula C9H21N3
and a molecular weight of 171.29 g/mol. Its IUPAC name is N'-aminononanimidamide.
Molecular Properties
| Compound Name | N'-aminononanimidamide |
| PubChem CID | 4100069 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | N'-aminononanimidamide |
| SMILES | CCCCCCCCC(N)=NN |
| InChI | InChI=1S/C9H21N3/c1-2-3-4-5-6-7-8-9(10)12-11/h2-8,11H2,1H3,(H2,10,12) |
| InChIKey | MRQTUHZRMWMJLN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-aminononanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-aminononanimidamide?
The IUPAC name of N'-aminononanimidamide (CID 4100069) is N'-aminononanimidamide.
What is the SMILES notation for N'-aminononanimidamide?
The canonical SMILES for N'-aminononanimidamide is CCCCCCCCC(N)=NN.
What is the InChIKey of N'-aminononanimidamide?
The InChIKey is MRQTUHZRMWMJLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3/c1-2-3-4-5-6-7-8-9(10)12-11/h2-8,11H2,1H3,(H2,10,12).
What are the key properties of N'-aminononanimidamide?
N'-aminononanimidamide has a molecular weight of 171.29 g/mol, XLogP of 1.97, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-aminononanimidamide is sourced from PubChem (CID 4100069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).