About decan-5-ylidenehydrazine
decan-5-ylidenehydrazine (PubChem CID 86114328) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is decan-5-ylidenehydrazine.
Molecular Properties
| Compound Name | decan-5-ylidenehydrazine |
| PubChem CID | 86114328 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | decan-5-ylidenehydrazine |
| SMILES | CCCCCC(CCCC)=NN |
| InChI | InChI=1S/C10H22N2/c1-3-5-7-9-10(12-11)8-6-4-2/h3-9,11H2,1-2H3 |
| InChIKey | ORBXTIRZMFHURM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze decan-5-ylidenehydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-5-ylidenehydrazine?
The IUPAC name of decan-5-ylidenehydrazine (CID 86114328) is decan-5-ylidenehydrazine.
What is the SMILES notation for decan-5-ylidenehydrazine?
The canonical SMILES for decan-5-ylidenehydrazine is CCCCCC(CCCC)=NN.
What is the InChIKey of decan-5-ylidenehydrazine?
The InChIKey is ORBXTIRZMFHURM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2/c1-3-5-7-9-10(12-11)8-6-4-2/h3-9,11H2,1-2H3.
What are the key properties of decan-5-ylidenehydrazine?
decan-5-ylidenehydrazine has a molecular weight of 170.30 g/mol, XLogP of 3.07, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decan-5-ylidenehydrazine is sourced from PubChem (CID 86114328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).