About nonan-4-ylidenehydrazine
nonan-4-ylidenehydrazine (PubChem CID 140571520) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is nonan-4-ylidenehydrazine.
Molecular Properties
| Compound Name | nonan-4-ylidenehydrazine |
| PubChem CID | 140571520 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | nonan-4-ylidenehydrazine |
| SMILES | CCCCCC(CCC)=NN |
| InChI | InChI=1S/C9H20N2/c1-3-5-6-8-9(11-10)7-4-2/h3-8,10H2,1-2H3 |
| InChIKey | CTUPRUIHHBSQSP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nonan-4-ylidenehydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonan-4-ylidenehydrazine?
The IUPAC name of nonan-4-ylidenehydrazine (CID 140571520) is nonan-4-ylidenehydrazine.
What is the SMILES notation for nonan-4-ylidenehydrazine?
The canonical SMILES for nonan-4-ylidenehydrazine is CCCCCC(CCC)=NN.
What is the InChIKey of nonan-4-ylidenehydrazine?
The InChIKey is CTUPRUIHHBSQSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2/c1-3-5-6-8-9(11-10)7-4-2/h3-8,10H2,1-2H3.
What are the key properties of nonan-4-ylidenehydrazine?
nonan-4-ylidenehydrazine has a molecular weight of 156.27 g/mol, XLogP of 2.68, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nonan-4-ylidenehydrazine is sourced from PubChem (CID 140571520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).