C10H24N6 — CID 6003047
1-N',10-N'-diaminodecanediimidamide (PubChem CID 6003047) has the molecular formula C10H24N6 and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-N',10-N'-diaminodecanediimidamide.
| Compound Name | 1-N',10-N'-diaminodecanediimidamide |
|---|---|
| PubChem CID | 6003047 |
| Molecular Formula | C10H24N6 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 1-N',10-N'-diaminodecanediimidamide |
| SMILES | N/N=C(/N)CCCCCCCC/C(N)=N\N |
| InChI | InChI=1S/C10H24N6/c11-9(15-13)7-5-3-1-2-4-6-8-10(12)16-14/h1-8,13-14H2,(H2,11,15)(H2,12,16) |
| InChIKey | XIMHZCOKXSUNNO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|